TCEP
From Wikipedia, the free encyclopedia
| TCEP | |
|---|---|
| IUPAC name | tris(2-carboxyethyl)phosphine hydrochloride |
| Other names | TCEP |
| Identifiers | |
| CAS number | [51805-45-9] |
| SMILES | OC(CCP(CCC(O)=O)CCC(O)=O)=O |
| Properties | |
| Molecular formula | C9H16O6PCl |
| Molar mass | 286.65 g mol−1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
TCEP (tris(2-carboxyethyl)phosphine) is a reducing agent frequently used in biochemistry and molecular biology applications. It is often prepared and used as a hydrochloride salt. TCEP is also available as a stabilized solution at neutral pH and immobilized onto an agarose support to facilitate removal of the reducing agent.
[edit] Applications
TCEP is often used as a reducing agent to break disulfide bonds within and between proteins as a preparatory step for gel electrophoresis.
Compared to the other two most common agents used for this purpose (dithiothreitol (DTT) and β-mercaptoethanol), TCEP has the advantage of being odourless, more powerful reductant, irreversible reductant, more hydrophilic and is more resistant to oxidation in air. TCEP also does not reduce metals used in immobilized metal affinity chromatography.

