Sulforhodamine B

From Wikipedia, the free encyclopedia

Sulforhodamine B
IUPAC name	2-(3-diethylamino-6-diethylazaniumylidene-xanthen-9-yl)-5-sulfo-benzenesulfonate
EINECS number	220-025-2
Identifiers
CAS number	[3520-42-1]
PubChem	65191
SMILES	O=S(=O)(O)c4ccc(C=1c3c(OC=2C=1\C=C/C(=[N+](/CC)CC)/C=2)cc(cc3)N(CC)CC)c(c4)S([O-])(=O)=O
InChI key	IOOMXAQUNPWDLL-UHFFFAOYAJ
Properties
Molecular formula	C27H30N2O7S2
Molar mass	558.6663 g/mol
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references

Sulforhodamine B or Kiton Red (C₂₇H₃₀N₂O₇S₂; Molecular Weight 558.66 grams/mole) is a fluorescent dye with uses spanning from L.I.F.(Laser Induced Fluorescense) to the quantification of cellular proteins of cultured cells. The red, solid, water soluble dye is primarily used as a polar tracer.

The dye absorbs 565nm light and emits 586nm light. It does not exhibit pH dependent absorption or fluorescence over the range of 3 to 10^[1].

[edit] References