Succinylmonocholine
From Wikipedia, the free encyclopedia
| Succinylmonocholine | |
|---|---|
 |
|
| IUPAC name | 2-(3-carboxy-1-oxo-propoxy)ethyl-trimethyl-ammonium |
| Identifiers | |
| CAS number | [5518-77-4] |
| PubChem | |
| MeSH | |
| SMILES | C[N+](C)(C)CCOC(=O)CCC(=O)O |
| Properties | |
| Molecular formula | C9H18NO4+ |
| Molar mass | 204.244 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Succinylmonocholine is an ester of succinic acid and choline created by the metabolism of suxamethonium chloride.
[edit] See also
 |
This article about an ester is a stub. You can help Wikipedia by expanding it. |
