Sorbitan
From Wikipedia, the free encyclopedia
| Sorbitan | |
|---|---|
 |
|
| IUPAC name | (3S)-2-(1,2-Dihydroxyethyl)tetrahydrofuran-3,4-diol |
| Identifiers | |
| CAS number | [12441-09-7] |
| PubChem | |
| SMILES | C1C([C@@H](C(O1)C(CO)O)O)O |
| Properties | |
| Molecular formula | C6H12O5 |
| Molar mass | 164.16 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Sorbitan is a mixture of chemical compounds derived from the dehydration of sorbitol. The mixture can vary, but usually consists of 1,4-anhydrosorbitol, 1,5-anhydrosorbitol and 1,4,3,6-dianhydrosorbitol.[1] Sorbitan is primarily used in the production of surfactants such as polysorbates.
[edit] References
- ^ Merck Index, 12th Edition, 8872.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
