Sodium lauroyl sarcosinate
From Wikipedia, the free encyclopedia
| Sodium lauroyl sarcosinate | |
|---|---|
 |
|
| IUPAC name | sodium [dodecanoyl(methyl)amino]acetate |
| Identifiers | |
| CAS number | [137-16-6] |
| PubChem | |
| Properties | |
| Molecular formula | CH3(CH2)10CON(CH3)CH2COONa |
| Molar mass | 293.38 g/mol |
| Melting point |
-1 °C, 272 K, 30 °F |
| Boiling point |
100 °C, 373 K, 212 °F |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Sodium lauroyl sarcosinate (INCI), also known as sarkosyl, is an ionic surfactant derived from sarcosine, used as a foaming and cleansing agent in shampoo, shaving foam and foam wash products.
 |
This chemistry article is a stub. You can help Wikipedia by expanding it. |
