SN-38
From Wikipedia, the free encyclopedia
| SN-38 | |
|---|---|
 |
|
| Other names | 7-Ethyl-10-hydroxy-camptothecin |
| Identifiers | |
| CAS number | [86639-52-3] |
| PubChem | |
| SMILES | CCC1=C2C=C(C=CC2=NC3=C1CN4C3=CC5=C(C4=O)COC(=O)C5(CC)O)O |
| Properties | |
| Molecular formula | C22H20N2O5 |
| Molar mass | 392.404 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
SN-38 is a metabolite of irinotecan (an analog of camptothecin - a topoisomerase I inhibitor), which is 200 times more active than irinotecan itself.
 |
This oncology article is a stub. You can help Wikipedia by expanding it. |
