Setiptiline
From Wikipedia, the free encyclopedia
| Setiptiline | |
|---|---|
 |
|
| IUPAC name | 2,3,4,9-Tetrahydro-2-methyl-1H-dibenzo(3,4:6,7)cyclohepta(1,2-c)pyridine |
| Identifiers | |
| CAS number | |
| PubChem | |
| MeSH | |
| SMILES | CN1CCC2=C(C1)C3=CC=CC=C3CC4=CC=CC=C24 |
| Properties | |
| Molecular formula | C19H19N |
| Molar mass | 261.361 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Setiptiline is an experimental tetracyclic antidepressant.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
