Sclareolide
From Wikipedia, the free encyclopedia
| Sclareolide | |
|---|---|
 |
|
| IUPAC name | 3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-
octahydronaphtho[8,7-d]furan-2-one |
| Identifiers | |
| CAS number | [564-20-5] |
| PubChem | |
| SMILES | CC1(CCCC2(C1CCC3(C2CC(=O)O3)C)C)C |
| Properties | |
| Molecular formula | C16H26O2 |
| Molar mass | 250.376 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Sclareolide is a terpenoid natural product, which is a close analogue of sclareol, a plant antifungal compound.[1]
[edit] References
- ^ Jasiński M, Stukkens Y, Degand H, Purnelle B, Marchand-Brynaert J, Boutry M (2001). "A plant plasma membrane ATP binding cassette-type transporter is involved in antifungal terpenoid secretion". Plant Cell 13 (5): 1095–107. doi:. PMID 11340184.
