Saccharic acid
From Wikipedia, the free encyclopedia
| Saccharic acid | |
|---|---|
 |
|
| IUPAC name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
| Other names | Glucaric acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C(C(C(C(=O)O)O)O)(C(C(=O)O)O)O |
| Properties | |
| Molecular formula | C6H10O8 |
| Molar mass | 210.1388 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Saccharic acid, also called glucaric acid, is a chemical compound with the formula C6H10O8. It is derived by oxidizing a sugar such as glucose with nitric acid.[1]
[edit] References
- ^ Saccharic acid at Merriam-Webster's Medical Dictionary
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
