Rolofylline
From Wikipedia, the free encyclopedia
| Rolofylline | |
|---|---|
 |
|
| IUPAC name | 8-(Hexahydro-2,5-methanopentalen-3a(1H)-yl)-3,7-dihydro-1,3-dipropyl-1H-purine-2,6-dione |
| Identifiers | |
| CAS number | [136199-02-5] |
| PubChem | |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC) NC(=N2)C34CC5CC(C3)CC4C5 |
| Properties | |
| Molecular formula | C20H28N4O2 |
| Molar mass | 356.46 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Rolofylline (KW-3902) is an experimental diuretic.[1]
[edit] References
- ^ Givertz MM, Massie BM, Fields TK, Pearson LL, Dittrich HC (October 2007). "The effects of KW-3902, an adenosine A1-receptor antagonist,on diuresis and renal function in patients with acute decompensated heart failure and renal impairment or diuretic resistance". J. Am. Coll. Cardiol. 50 (16): 1551–60. doi:. PMID 17936154.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
