User:Rifleman 82/Cholesterol
From Wikipedia, the free encyclopedia
| Rifleman 82/Cholesterol | |
|---|---|
 |
|
 |
|
| IUPAC name |
(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H- cyclopenta[a]phenanthren-3-ol |
| Identifiers | |
| CAS number | [57-88-5] |
| PubChem | |
| SMILES |
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Properties | |
| Molecular formula | C27H46O |
| Molar mass | 386.654 |
| Appearance | white crystalline powder [1] |
| Melting point |
148-150 °C [1] |
| Boiling point |
360 °C (decomposes) |
| Solubility in water | 0.095 mg/l (30 °C) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
