Ribitol
From Wikipedia, the free encyclopedia
| Ribitol | |
|---|---|
 |
|
| IUPAC name | (2R,3s,4S)-Pentane-1,2,3,4,5-pentol Pentane-1,2,3,4,5-pentol |
| Other names | Adonit, Adonite, Adonitol, Adonitrol, Pentitol, 1,2,3,4,5-Pentanepentol, 1,2,3,4,5-Pentanol |
| Identifiers | |
| CAS number | [488-81-3] |
| PubChem | |
| SMILES | O[C@@H](CO)[C@H](O)[C@H](O)CO OCC(O)C(O)C(O)CO |
| InChI | 1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| Properties | |
| Molecular formula | C5H12O5 |
| Molar mass | 152.15 g/mol |
| Melting point |
102 °C |
| Hazards | |
| R-phrases | — |
| S-phrases | S22 S24/25 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ribitol or adonitol is a crystalline pentose alcohol (C5H12O5) formed by the reduction of ribose. It occurs naturally in the plant Adonis vernalis.
[edit] External links
 |
This article about an alcohol is a stub. You can help Wikipedia by expanding it. |
