Rhodoxanthin
From Wikipedia, the free encyclopedia
| Rhodoxanthin[1] | |
|---|---|
 |
|
| IUPAC name | (4E)-3,5,5-Trimethyl-4-[(2E,4E,6E,8E,10E,12E,14E,16E,18E)-3,7,12,16-Tetramethyl-18-(2,6,6-trimethyl-4-oxo-1-cyclohex-2-enylidene)octadeca-2,4,6,8,10,12,14,16-octaenylidene]-1-cyclohex-2-enone |
| Other names | •4',5'-Didehydro-retro-β-carotene-3,3'-dione •E161f |
| Identifiers | |
| CAS number | [116-30-3] |
| PubChem | |
| SMILES | CC1=CC(=O)CC(C1=CC=C(C)C=CC=C(C)C=CC=CC(=CC=CC(=CC=C2C(=CC(=O)CC2(C)C)C)C)C)(C)C |
| Properties | |
| Molecular formula | C40H50O2 |
| Molar mass | 562.82 g/mol |
| Appearance | Purple crystals |
| Melting point |
219 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Rhodoxanthin is a xanthophyll pigment with a purple color that is found in small quantities in a variety plants including Taxus baccata. It is also found in the feathers of some birds.[1] As a food additive it is used under the E number E161f as a food coloring.
[edit] References
- ^ a b Merck Index, 11th Edition, 8196.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
