Reversine
From Wikipedia, the free encyclopedia
| Reversine | |
|---|---|
 |
|
| IUPAC name | N'-cyclohexyl-N-(4-morpholinophenyl)-7H-purine-2,6-diamine |
| Identifiers | |
| CAS number | [656820-32-5] |
| PubChem | |
| SMILES | C1CCC(CC1)NC2=NC(=NC3=C2NC=N3)NC4=CC=C(C=C4)N5CCOCC5 |
| Properties | |
| Molecular formula | C21H27N7O |
| Molar mass | 393.48538 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Reversine, or 2-(4-morpholinoanilino)-6-cyclohexylaminopurine, is a small molecule developed by the group of Peter Schultz, used for stem cell dedifferentiation.
[edit] External links
 |
This article about a heterocyclic compound is a stub. You can help Wikipedia by expanding it. |
