Red-Al
From Wikipedia, the free encyclopedia
| Red-Al | |
|---|---|
 |
|
| IUPAC name | bis(2-methoxyethoxy)aluminumhydride |
| Identifiers | |
| CAS number | [22722-98-1] |
| SMILES | [H][Al-](OCCOC)([H])OCCOC.[Na+] |
| Properties | |
| Molecular formula | NaAlH2(OCH2CH2OCH3)2 |
| Molar mass | 202.16 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Red-Al, or sodium bis(2-methoxyethoxy)aluminumhydride, is a reagent used in organic synthesis primarily as a reducing agent or source of hydride.
[edit] See also
[edit] External links
- Red-Al, Sodium bis(2-methoxyethoxy)aluminumhydride at organic-chemistry.org
 |
This organic chemistry article is a stub. You can help Wikipedia by expanding it. |
