Ranirestat
From Wikipedia, the free encyclopedia
| Ranirestat | |
|---|---|
| IUPAC name | (3R)-2'-[(4-bromo-2-fluorophenyl)methyl] spiro[pyrrolidine-3,4'-pyrrolo[1,2-d]pyrazine]- 1',2,3',5-tetrone |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1C(=O)NC(=O)C12C(=O)N(C(=O)C3=CC=CN23) CC4=C(C=C(C=C4)Br)F |
| Properties | |
| Molecular formula | C17H11BrFN3O4 |
| Molar mass | 420.189 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ranirestat is an aldose reductase inhibitor.

