Pyroglutamyl-histidyl-glycine
From Wikipedia, the free encyclopedia
| Pyroglutamyl-histidyl-glycine | |
|---|---|
 |
|
| IUPAC name | 2-[ [(2S)-3-(4H-imidazol-4-yl)-2-[ [(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoyl]amino]acetic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1CC(=O)N[C@@H]1C(=O)N[C@@H](CC2C=NC=N2)C(=O)NCC(=O)O |
| Properties | |
| Molecular formula | C13H17N5O5 |
| Molar mass | 323.30458 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pyroglutamyl-histidyl-glycine is an anorectic.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
