Pseudaconitine
From Wikipedia, the free encyclopedia
| Pseudaconitine | |
|---|---|
 |
|
| Other names | 1α,6α,14α(E),16β-20-Ethyl-1,6,16-trimethoxy-4-methoxymethyl-3,13-dihydroxyaconitane-8,14-diyl 8-acetate 14-(3,4-dimethoxybenzoate) |
| Identifiers | |
| CAS number | [127-29-7] |
| PubChem | |
| SMILES | CCN1CC2(C(CC(C34C2C(C(C31)C5(CC(C6(CC4C5C6OC(=O)C7=CC(=C(C=C7)OC)OC)O)OC)OC(=O)C)OC)OC)O)COC |
| Properties | |
| Molecular formula | C36H51NO12 |
| Molar mass | 689.79 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pseudaconitine (C36H49NO12) is an alkaloid found in high quantities in the roots of Aconitum ferox.
It is extremely poisonous.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
