Propiconazole
From Wikipedia, the free encyclopedia
| Propiconazole[1] | |
|---|---|
| IUPAC name | 1-[ [2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| Identifiers | |
| CAS number | [60207-90-1] |
| PubChem | |
| SMILES | CCCC1COC(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl |
| Properties | |
| Molecular formula | C15H17Cl2N3O2 |
| Molar mass | 342.22038 |
| Boiling point |
180 °C at 0.1 mmHg [1] |
| Solubility in water | 100 ppm at 20 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Propiconazole is a triazole fungicide used agriculturally on grasses grown for seed, mushrooms, corn, wild rice, peanuts, almonds, sorghum, oats, pecans, apricots, peaches, nectarines, plums and prunes.[2] Propiconazole was first developed in 1979 by Janssen Pharmaceutica.[3]

