Potassium fumarate
From Wikipedia, the free encyclopedia
| Potassium fumarate | |
|---|---|
 |
|
| IUPAC name | dipotassium (E)-but-2-enedioate |
| Other names | potassium fumarate, potassium (E)-butenedioate, Dipotassium fumarate, Fumaric acid, EINECS 223-979-8, 4151-35-3, 7704-72-5 |
| Identifiers | |
| CAS number | [7704-72-5] |
| PubChem | |
| SMILES | C(=CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| Properties | |
| Molecular formula | K2C4H2O4 |
| Molar mass | 192.253g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Potassium fumarate is a compound with formula K2C4H2O4. It is the potassium salt of fumaric acid.
It has E number "E366".
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
