Porphobilinogen
From Wikipedia, the free encyclopedia
| Porphobilinogen | |
|---|---|
 |
|
| IUPAC name | 3-[5-(Aminomethyl)-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid |
| Identifiers | |
| CAS number | [487-90-1] |
| PubChem | |
| EINECS number | |
| MeSH | |
| SMILES | C1=C(C(=C(N1)CN)CC(=O)O)CCC(=O)O |
| Properties | |
| Molecular formula | C10H14N2O4 |
| Molar mass | 226.229 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Porphobilinogen (PBG) is a pyrrole involved in porphyrin metabolism.
It is generated by aminolevulinate (ALA) and the enzyme ALA dehydratase. PBG is then converted into hydroxymethyl bilane by the enzyme porphobilinogen deaminase.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
