Piroctone olamine
From Wikipedia, the free encyclopedia
| Piroctone olamine | |
|---|---|
 |
|
| Identifiers | |
| CAS number | [68890-66-4] |
| PubChem | |
| MeSH | |
| SMILES | CC1=CC(=O)N(C(=C1)CC(C)CC(C)(C)C)O.C(CO)N |
| Properties | |
| Molecular formula | C16H30N2O3 |
| Molar mass | 298.421 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Piroctone olamine is a compound sometimes used in the treatment of fungal infections.[1]
It is often used in anti-dandruff shampoo as a replacement for the commonly used material Zinc pyrithione.
[edit] References
- ^ Dubini F, Bellotti MG, Frangi A, Monti D, Saccomani L (2005). "In vitro antimycotic activity and nail permeation models of a piroctone olamine (octopirox) containing transungual water soluble technology". Arzneimittel-Forschung 55 (8): 478–83. PMID 16149717.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
