Pirimicarb
From Wikipedia, the free encyclopedia
| Pirimicarb | |
|---|---|
 |
|
| IUPAC name | (2-Dimethylamino-5,6-dimethylpyrimidin-4-yl) N,N-dimethylcarbamate |
| Identifiers | |
| CAS number | [23103-98-2] |
| PubChem | |
| SMILES | CC1=C(N=C(N=C1OC(=O)N(C)C)N(C)C)C |
| Properties | |
| Molecular formula | C11H18N4O2 |
| Molar mass | 238.29 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pirimicarb is a carbamate insecticide used to control aphids on vegetable, cereal and orchard crops by inhibiting acetylcholinesterase activity.[1]
[edit] References
- ^ McGregor, D. B. (2006), Pesticide Residues in Food - 2004, Food and Agriculture Organization, World Health Organization, pp. p. 207, ISBN 9241665203, <http://books.google.co.uk/books?id=Q8qhjfKFMf4C&pg=PA207&dq=Pirimicarb&sig=LRW1wXt5S5WE6oqeK0hEyBOhp4s>. Retrieved on 8 May 2008
 |
This chemistry article is a stub. You can help Wikipedia by expanding it. |
