Pindone
From Wikipedia, the free encyclopedia
| Pindone | |
|---|---|
 |
|
| IUPAC name | 2-(2,2-Dimethyl-1-oxopropyl)indane-1,3-dione |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CC(C)(C)C(=O)C1C(=O)C2=CC=CC=C2C1=O |
| Properties | |
| Molecular formula | C14H14O3 |
| Molar mass | 230.26 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pindone is an anticoagulant drug for agricultural use. It is commonly used as a rodenticide in the management of rat and rabbit populations. It is pharmacologically analogous to warfarin and inhibits the synthesis of Vitamin K-dependent clotting factors.
 |
This agriculture-related article is a stub. You can help Wikipedia by expanding it. |
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
