Phoxim
From Wikipedia, the free encyclopedia
| Phoxim[1] | |
|---|---|
![]() |
|
| IUPAC name | N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide |
| Other names | Baythion Valexone Phoxime Sebacil Valexon Volaton |
| Identifiers | |
| CAS number | [14816-18-3] |
| PubChem | |
| MeSH | |
| SMILES | CCOP(=S)(OCC)ON=C(C#N)C1=CC=CC=C1 |
| Properties | |
| Molecular formula | C12H15N2O3PS |
| Molar mass | 298.3 g mol-1 |
| Appearance | Brownish red liquid |
| Density | 1.17 g/cm3 |
| Melting point |
6.1 °C, 279 K, 43 °F |
| Boiling point |
102 |
| Solubility in water | 7ppm |
| Hazards | |
| R-phrases | 22 - 50/53 |
| S-phrases | 2 - 36 - 60 - 61 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Phoxim is a organophosphate insecticide by Bayer. It is banned for use on crops in the European Union since 22 december 2007.[2]


