Perillartine
From Wikipedia, the free encyclopedia
| Perillartine | |
|---|---|
 |
|
| IUPAC name | (S)-4-(Prop-1-en-2-yl)cyclohex-1-ene- carbaldehyde oxime |
| Identifiers | |
| CAS number | [30950-27-7] |
| SMILES | CC([C@H]1CCC(/C=N/O)=CC1)=C |
| Properties | |
| Molecular formula | C10H15NO |
| Molar mass | 165.23 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Perillartine, also known as perillartin and perilla sugar, is a sweetener that is about 2000 times as sweet as sucrose which is mainly used in Japan. Perillartine is the oxime of perillaldehyde.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
