Perfluoroisobutene
From Wikipedia, the free encyclopedia
| Perfluoroisobutene | |
|---|---|
 |
|
| IUPAC name | 1,1,3,3,3-pentafluoro-2-(trifluoromethyl)prop-1-ene |
| Other names | Perfluoroisobutene, Perfluoroisobutylene, Octafluoroisobutylene, Octafluoro-sec-butene, PFIB |
| Identifiers | |
| CAS number | [382-21-8] |
| PubChem | |
| RTECS number | UD1800000 |
| SMILES | C(=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | 1/C4F8/c5-2(6)1(3(7,8)9)4(10,11)12 |
| Properties | |
| Molecular formula | C4F8 |
| Molar mass | 200.030 g/mol |
| Density | 8.2 g/l |
| Boiling point |
7.0 °C (280 K) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Perfluoroisobutene (PFIB), also known as 1,1,3,3,3-pentafluoro-2-(trifluoromethyl)prop-1-ene, is a fluorinated olefine. It is a hydrophobic reactive gas with boiling point at 7 °C. It is a strong electrophile.
PFIB is about 10 times as toxic as phosgene. Its inhalation can lead to pulmonary edema, which may be fatal. Onset of symptoms can take 1-4 hours after inhalation. Treatment is based on management of the pulmonary edema (usually with high-dose corticoids and other medication/measures) and associated disorders (e.g. heart failure, hypocalcemia etc.). Many cases resolve within 72 hours without major long-term effects.
In contact with water PFIB undergoes rapid hydrolysis, producing various reactive compounds and fluorophosgene.
PFIB is a product of pyrolysis of polytetrafluoroethylene (PTFE), one of the substances causing polymer fume fever.
It is a Schedule 2 substance of the Chemical Weapons Convention.
