Pendimethalin
From Wikipedia, the free encyclopedia
| Pendimethalin[1] | |
|---|---|
| IUPAC name | 3,4-Dimethyl-2,6-dinitro-N-pentan-3-yl-aniline |
| Identifiers | |
| CAS number | [40487-42-1] |
| PubChem | |
| SMILES | CCC(CC)NC1=C(C=C(C(=C1[N+](=O)[O-])C)C)[N+](=O)[O-] |
| Properties | |
| Molecular formula | C13H19N3O4 |
| Molar mass | 281.308 g/mol |
| Density | 1.17 g/cm³ |
| Melting point |
47-58 °C |
| Boiling point |
330 °C, 603 K, 626 °F |
| Solubility in water | 0.275 ppm |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pendimethalin is a preemergent herbicide used to prevent crabgrass from germinating. It inhibits cell division and cell elongation. It must be "watered in" so that the chemical reaches the seeds deep in the soil.
[edit] Tradenames
- Pendulum; BASF

