para-Nitrophenylphosphate
From Wikipedia, the free encyclopedia
| Para-Nitrophenylphosphate | |
|---|---|
 |
|
| IUPAC name | (4-nitrophenyl) dihydrogen phosphate |
| Other names | pNPP |
| Identifiers | |
| CAS number | [33013-2] |
| PubChem | |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)O |
| Properties | |
| Molecular formula | C6H6NO6P |
| Molar mass | 219.088701 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
para-Nitrophenylphosphate (pNPP) is a chromogenic substrate for acid and alkaline phosphatase in ELISA assays. Under their influence the decay to yellow para-nitrophenol is catalysed. This product can be measured with a 405 nm spectrophotometer.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
