Oxalyldiaminopropionic acid
From Wikipedia, the free encyclopedia
| Oxalyldiaminopropionic acid | |
|---|---|
 |
|
| IUPAC name | 3-amino-2-(oxaloamino)propanoic acid |
| Identifiers | |
| CAS number | [7554-89-4] |
| PubChem | |
| SMILES | C(C(C(=O)O)NC(=O)C(=O)O)N |
| Properties | |
| Molecular formula | C5H8N2O5 |
| Molar mass | 176.127 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Oxalyldiaminopropionic acid is the neurotoxin responsible for lathyrism.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
