Oxalosuccinic acid

From Wikipedia, the free encyclopedia

Oxalosuccinic acid
IUPAC name	1-Oxopropane-1,2,3-tricarboxylic acid
Identifiers
CAS number	[1948-82-9]
PubChem	972
SMILES	C(C(C(=O)C(=O)O)C(=O)O)C(=O)O
Properties
Molecular formula	C6H6O7
Molar mass	190.11 g mol-1
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references

Oxalosuccinic acid is a substrate of the citric acid cycle. It is acted upon by isocitrate dehydrogenase. Salts and esters of oxalosuccinic acid are known as oxalosuccinates.

v • d • e Citric Acid Cycle Metabolic Pathway
Oxaloacetate Malate Fumarate Succinate Succinyl-CoA Acetyl-CoA NADH + H+ NAD+ H2O FADH2 FAD CoA + ATP(GTP) Pi + ADP(GDP) + H2O NADH + H+ + CO2 CoA NAD+ H2O H2O NAD(P)+ NAD(P)H + H+ CO2 Citrate cis-Aconitate Isocitrate Oxalosuccinate α-Ketoglutarate