Oleyl alcohol
From Wikipedia, the free encyclopedia
| Oleyl alcohol[1] | |
|---|---|
 |
|
| IUPAC name | (Z)-Octadec-9-en-1-ol |
| Other names | Octadecenol cis-9-Octadecen-1-ol |
| Identifiers | |
| CAS number | [143-28-2] |
| PubChem | |
| SMILES | CCCCCCCC\C=C/CCCCCCCCO |
| Properties | |
| Molecular formula | C18H36O |
| Molar mass | 268.478 g/mol |
| Density | 0.845-0.855 g/cm3 |
| Melting point |
13-19 °C |
| Boiling point |
330-360 °C |
| Solubility in water | Insoluble |
| Hazards | |
| NFPA 704 |
 0
1
0
|
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Oleyl alcohol, octadecenol, or cis-9-octadecen-1-ol, is a fatty alcohol coming from inedible beef fat. It is also found in fish oil. Its chemical formula is C18H36O or CH3(CH2)7-CH=CH-(CH2)8OH.
It is a non-ionic, unsaturated fatty alcohol.
It has uses as a nonionic surfactant, emulsifier, emollient and thickener in skin creams, lotions and many other cosmetic products, plasticizer for softening fabrics, surfactant and hair coating in shampoos and hair conditioners, and a carrier for medications.[2]
[edit] References
[edit] External links
 |
This article about an alcohol is a stub. You can help Wikipedia by expanding it. |
