Octachlorodibenzodioxin
From Wikipedia, the free encyclopedia
| Octachlorodibenzodioxin | |
|---|---|
| IUPAC name | 1,2,3,4,6,7,8,9-Octachlorooxanthrene |
| Other names | OCDD, Octachlorodibenzo-p-dioxin |
| Identifiers | |
| CAS number | [3268-87-9] |
| PubChem | |
| SMILES | ClC1=C2C(OC(C(Cl)=C(Cl)C(Cl)=C3Cl)=C3O2)=C(Cl)C(Cl)=C1Cl |
| Properties | |
| Molecular formula | C12Cl8O2 |
| Molar mass | 459.75 g/mol |
| Related compounds | |
| Related Polychlorinated dibenzodioxins | Tetrachlorodibenzodioxin, Trichlorodibenzodioxin |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Octachlorodibenzodioxin is a polychlorinated dibenzodioxin (PCDD). It is a teratogen, mutagen, and a possible carcinogen.[citation needed]

