Octabenzone
From Wikipedia, the free encyclopedia
| Octabenzone | |
|---|---|
| IUPAC name | (2-hydroxy-4-octoxy-phenyl)-phenyl-methanone |
| Other names | Benzophenone-12, Spectra-Sorb UV 531 |
| Identifiers | |
| CAS number | [1843-05-6] |
| PubChem | |
| MeSH | |
| SMILES | CCCCCCCCOC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O |
| Properties | |
| Molecular formula | C21H26O3 |
| Molar mass | 326.429 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Octabenzone (Spectra-Sorb UV 531, C21H26O3) is a UV absorber/screener. It's used to protect polymers (e.g., polyethylene, polypropylene, polyvinylchloride) against damage by UV light.

