Nile blue
From Wikipedia, the free encyclopedia
| Nile blue | |
|---|---|
 |
|
 |
|
| IUPAC name | Nile blue |
| Other names | Nile blue A |
| Identifiers | |
| CAS number | [3625-57-8] |
| PubChem | |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C4= CC=CC=C4C(=[NH2+])C=C3O2.[Cl-] |
| Properties | |
| Molecular formula | C20H20ClN3O |
| Molar mass | 353.845 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Nile blue (or Nile blue A) is a stain used in biology and histology. It may be used with live or fixed cells, and imparts a blue colour to cell nuclei.
It may also be used in conjunction with fluorescence microscopy to stain for the presence of polyhydroxybutyrate granules in prokaryotic or eukaryotic cells. Boiling a solution of Nile blue with sulfuric acid produces Nile red (Nile blue oxazone).
