N-Formylmethionine (data page)
From Wikipedia, the free encyclopedia
| The complete data for N-Formylmethionine | ||||||||||||||||
![]() |
General information Chemical formula: C6H11NO3S
Molar mass: ? g·mol-1 Systematic name: 2-formamido-4-methylsulfanyl-butanoic acid Synonyms: 2-Formylamino-4-methylsulfanyl-butyric acid Formylmethionine N-FORMYLMETHIONINE N-Formyl(methyl)homocysteine N-Formyl-DL-methionine N-formyl-L-methionine N-formyl-methionine NSC 334322 |
|||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CSCCC(C(=O)O)NC=O InChI=1/C6H11NO3S/c1-11-3-2-5(6(9)10)7-4-8/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10)/f/h7,9H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||


