N-Acetylmannosamine
From Wikipedia, the free encyclopedia
| N-Acetylmannosamine | |
|---|---|
 |
|
| IUPAC name | 2-(Acetylamino)-2-deoxy-β-D-mannopyranose |
| Identifiers | |
| CAS number | [7772-94-3] |
| PubChem | |
| SMILES | OCC1C(O)C(O)C(NC(C)=O)C(O)O1 |
| Properties | |
| Molecular formula | C8H15NO6 |
| Molar mass | 221.21 g/mol |
| Melting point |
118-121 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
N-Acetylmannosamine is a monosaccharide involved in a range of metabolic processes. It is an amino sugar/amino acid that consists of neuraminic acids, glycolipids and glycoproteins, and is used for the synthesis of sialic acid.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
