Mutisianthol
From Wikipedia, the free encyclopedia
| Mutisianthol | |
|---|---|
 |
|
| Identifiers | |
| CAS number | |
| SMILES | CC(C)=CC1CC(C)c(cc2O)c1cc2C |
| Properties | |
| Molecular formula | C15H20O |
| Molar mass | 216.319 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Mutisianthol is a compound found in Mutisia homoeantha.
[edit] References
- The Bohlmann Files: Chemical compounds query results
- da Silva, Gil V. J.; Álvaro Cunha Neto (2005 August 8). "Calculated NMR as a tool for structural elucidation of jungianol and mutisianthol". Tetrahedron 61 (32): 7763–7767. doi:.
