Muramyl dipeptide
From Wikipedia, the free encyclopedia
| Muramyl dipeptide | |
|---|---|
 |
|
| IUPAC name | (4R)-4-[ [(2S)-2-[ [(2R)-2-[(2R,5S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoic acid |
| Other names | Acetylmuramyl-Alanyl-Isoglutamine |
| Identifiers | |
| CAS number | [53678-77-6] |
| PubChem | |
| MeSH | |
| SMILES | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC (=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Properties | |
| Molecular formula | C19H32N4O11 |
| Molar mass | 492.47758 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Muramyl dipeptide is a peptidoglycan constituent of both Gram positive and Gram negative bacteria.
[edit] See also
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
