Miotine
From Wikipedia, the free encyclopedia
| Miotine | |
|---|---|
| IUPAC name | dimethyl-[1-[3-(methylcarbamoyloxy)phenyl]ethyl]ammonium chloride |
| Identifiers | |
| CAS number | |
| SMILES | CC(C1=CC(=CC=C1)OC(=O)NC)[NH+](C)C.[Cl-] |
| Properties | |
| Molecular formula | C12H19ClN2O2 |
| Molar mass | 258.74 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Miotine is an anticholinesterase drug. Miotine was the first synthetic carbamate that was used clinically.[1]
Unlike miotine's analouge neostigmine it doesn't have a quaternary ammonium group to give it a permanent positive charge. It can therefore form it's unpolar free base which could allow it to cross the blood-brain barrier and cause unwanted central nervous system (CNS) side effects.[2]
![]()
[edit] References
- ^ "http://www.weizmann.ac.il/sb/faculty_pages/Sussman/papers/2002_Bar-On_Biochem.pdf"
- ^ "http://media.wiley.com/product_data/excerpt/72/04700259/0470025972.pdf"

