Metrifonate
From Wikipedia, the free encyclopedia
| Metrifonate | |
|---|---|
 |
|
| IUPAC name | 2,2,2-trichloro-1- dimethoxyphosphoryl-ethanol |
| Identifiers | |
| CAS number | [52-68-6] |
| PubChem | |
| MeSH | |
| SMILES | COP(=O)(C(C(Cl)(Cl)Cl)O)OC |
| Properties | |
| Molecular formula | C4H8Cl3O4P |
| Molar mass | 257.436 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Metrifonate (INN) or trichlorfon (USAN) is an organophosphate acetylcholinesterase inhibitor.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
|
|||||||||||
