Methylcholanthrene
From Wikipedia, the free encyclopedia
| 3–Methylcholanthrene | |
|---|---|
 |
|
| Other names | 20–Methylcholanthrene |
| Identifiers | |
| Abbreviations | 3-MC 20-MC |
| CAS number | [56-49-5] |
| PubChem | |
| SMILES | CC1=C2CCC3=C2C(=CC4=C3C=CC5=CC=CC=C54)C=C1 |
| Properties | |
| Molecular formula | C21H16 |
| Molar mass | 268.35174 |
| Appearance | Yellow solid |
| Melting point |
180 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Methylcholanthrene is a highly carcinogenic polycyclic aromatic hydrocarbon produced by burning organic compounds at very high temperatures. It is a yellow solid with a melting pont around 180 °C. Methylcholanthrene is used in laboratory studies of chemical carcinogenesis. It is an alkylated derivative of benz[a]anthracene and has a similar UV spectrum. The most common isomer is 3-methylcholanthrene, although the methyl group can occur in other places.
3-Methylcholanthrene, a known carcinogen which builds up in the prostate due to cholesterol breakdown, is implicated in prostate cancer.[1] It "readily produces" primary sarcomas in mice.[2]
[edit] External links
 |
This article about a hydrocarbon is a stub. You can help Wikipedia by expanding it. |
