Methiothepin
From Wikipedia, the free encyclopedia
| Methiothepin | |
|---|---|
| IUPAC name | 1-methyl-4-(8-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine |
| Identifiers | |
| CAS number | |
| PubChem | |
| MeSH | |
| SMILES | CSc1ccc2c(C(N3CCN(C)CC3)Cc4ccccc4S2)c1 |
| Properties | |
| Molecular formula | C20H24N2S2 |
| Molar mass | 356.548 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Methiothepin is a synthetic compound, that acts on subsets of both 5-HT receptors[1] and dopamine receptors[2] and is used as an antipsychotic.
[edit] References
- ^ Monachon MA, Burkard WP, Jalfre M, Haefely W (1972). "Blockade of central 5-hydroxytryptamine receptors by methiothepin". Naunyn Schmiedebergs Arch. Pharmacol. 274 (2): 192–7. PMID 4340797.
- ^ Dall'Olio R, Vaccheri A, Montanaro N (1985). "Reduced head-twitch response to quipazine of rats previously treated with methiothepin: possible involvement of dopaminergic system". Pharmacol. Biochem. Behav. 23 (1): 43–8. PMID 2994121.

