Metepa
From Wikipedia, the free encyclopedia
| Metepa | |
|---|---|
 |
|
| IUPAC name | 1-[Bis(2-methyl-1-aziridinyl)phosphoryl]-2-methylaziridine |
| Other names | •Methaphoxide •Metapoxide •Methyl aphoxide •METEPA •Trimethylaziridinylphosphine oxide •Tris(1,2-propylene)phosphoramide •Tris(2-methyl-1-aziridinyl)phosphine oxide |
| Identifiers | |
| CAS number | [57-39-6] |
| PubChem | |
| SMILES | CC1CN1P(=O)(N2CC2C)N3CC3C |
| Properties | |
| Molecular formula | C9H18N3OP |
| Molar mass | 215.23 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Metepa is a chemosterilant. It is also used in creaseproofing and flameproofing textiles.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
