Met-enkephalin
From Wikipedia, the free encyclopedia
| Met-enkephalin | |
|---|---|
 |
|
| IUPAC name | (2S)-2-[ [(2R)-2-[ [2-[ [2-[ [(2R)-2-amino-3- (4-hydroxyphenyl)propanoyl]amino]acetyl] amino]acetyl]amino]-3-phenylpropanoyl] amino]-4-methylsulfanylbutanoic acid |
| Identifiers | |
| CAS number | [58569-55-4] |
| PubChem | |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)[C@@H](CC1=CC=CC=C1) NC(=O)CNC(=O)CNC(=O)[C@@H](CC2=CC=C(C=C2)O)N |
| Properties | |
| Molecular formula | C27H35N5O7S |
| Molar mass | 573.6611 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Met-enkephalin is an endogenous opioid peptide neurotransmitter found naturally in the brains of many animals, including humans. It is one of the two forms of enkephalin; the other is leu-enkephalin. The tyrosine residue at position 1 is thought to be analogous to the 3-hydroxyl group on morphine.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
