Mesulergine
From Wikipedia, the free encyclopedia
| Mesulergine | |
|---|---|
| IUPAC name | N'-(1,6-Dimethylergolin-8alpha-yl)-N,N-dimethylsulfamide |
| Other names | CQ-32085 |
| Identifiers | |
| CAS number | [72786-12-0] |
| PubChem | |
| MeSH | |
| SMILES | Cn1cc(C[C@]2([H])[C@]3([H])C[C@H](CN([H])S(N(C)C)(=O)=O)CN2C)c4c3cccc41 |
| Properties | |
| Molecular formula | C18H26N4O2S |
| Molar mass | 362.49 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Mesulergine is a synthetic compound, that acts on subsets of both 5-HT receptors and dopamine receptors.

