Mesembrine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Mesembrine | ||||||||||||||||
| General information Chemical formula: C17H23NO3
Molar mass: 289.37 [1] g·mol-1 Systematic name: (3aS,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol- 6-one [1] Synonyms: 3a-(3,4-dimethoxyphenyl)octahydro-1-methyl-6H-indol-6-one |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CN1CC[C@@]2([C@H]1CC(=O)CC2)C3=CC(=C(C=C3)OC)OC [1] InChI=1/C17H23NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10,16H,6-9,11H2,1-3H3/t16-,17-/m1/s1 [1]
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||

