Mecoprop
From Wikipedia, the free encyclopedia
| Mecoprop[1] | |
|---|---|
 |
|
| IUPAC name | 2-(4-chloro-2-methylphenoxy)propanoic acid |
| Identifiers | |
| CAS number | [93-65-2] |
| PubChem | |
| SMILES | CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O |
| Properties | |
| Molecular formula | C10H11ClO3 |
| Molar mass | 214.645 |
| Appearance | Solid |
| Melting point |
93-94 °C |
| Solubility in water | Very soluble |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Mecoprop, or methylchlorophenoxypropionic acid (MCPP), is a common general use herbicide found in many household weed killers and "weed-and-feed" type lawn fertilizers.[2] It is primarily used to control broadleaf weeds.[3] It is often used in combination with other chemically related herbicides such as 2,4-D, dicamba, and MCPA.
Mecoprop is a mixture of two stereoisomers, with the (R)-(+)-enantiomer ("Mecoprop-P", "Duplosan KV") possessing the herbicidal activity.
The United States Environmental Protection Agency has classified mecoprop as toxicity class III - slightly toxic.[3]
