Manganese(II) phthalocyanine
From Wikipedia, the free encyclopedia
| Manganese(II) phthalocyanine | |
|---|---|
phtalocyanine.gif/200px-Manganese(II)phtalocyanine.gif) |
|
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Mn+2] |
| Properties | |
| Molecular formula | C32H16MnN8 |
| Molar mass | 567.461 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Manganese(II) phthalocyanine is a compound of manganese and phthalocyanine.
[edit] References
- ABP Lever, JP Wilshire, SK Quan (1981). "Oxidation of manganese (II) phthalocyanine by molecular oxygen". Inorganic Chemistry 20 (3): 761–768. doi:.
