Malvalic acid
From Wikipedia, the free encyclopedia
| Malvalic acid | |
|---|---|
 |
|
| IUPAC name | 7-(2-octyl-1-cyclopropenyl)heptanoic acid |
| Identifiers | |
| CAS number | [503-05-9] |
| PubChem | |
| SMILES | CCCCCCCCC1=C(C1)CCCCCCC(=O)O |
| Properties | |
| Molecular formula | C18H32O2 |
| Molar mass | 280.44548 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Malvalic acid is a cyclopropenic fatty acid found in cottonseed oil. The cyclopropene ring is thought to be one of the causes of abnormalities that develop in animals that ingest cottonseed oil.[1] This reactivity could be cause for concern depending on concentration. Reports that hydrogenation of the oil destroys malvalic acid are common.[citation needed]
[edit] See also
[edit] References
- ^ Joseph Hornback. "Organic Chemistry", Second Edition (2006), pg 207.
